CAS 198203-94-0

Benzonitrile, 2-fluoro-3-methoxy-

Description:

Benzonitrile, 2-fluoro-3-methoxy- is an organic compound characterized by its aromatic structure, featuring a nitrile group (-C≡N) attached to a benzene ring that also contains a fluorine atom and a methoxy group (-OCH₃) at specific positions. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive aromatic odor. Its molecular structure contributes to its chemical reactivity, making it useful in various synthetic applications, particularly in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, while the methoxy group can affect its solubility and reactivity. Benzonitrile derivatives are often studied for their potential applications in materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as with many nitriles, it may pose health risks if not managed properly.

Formula: C₈H₆FNO

InChI: InChI=1/C8H6FNO/c1-11-7-4-2-3-6(5-10)8(7)9/h2-4H,1H3

SMILES: COc1cccc(C#N)c1F

Synonyms:

• 2-Fluoro-3-methoxybenzonitrile

Benzonitrile, 2-fluoro-3-methoxy-

CAS: 198203-94-0

Formula: C₈H₆FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.1377

Ref: IN-DA002BCY

2-Fluoro-3-methoxybenzonitrile

CAS: 198203-94-0

2-Fluoro-3-methoxybenzonitrile

Purity: 97%

Color and Shape: Solid

Molecular weight: 151.14g/mol

Ref: 54-PC408254

2-Fluoro-3-methoxybenzonitrile

CAS: 198203-94-0

Formula: C₈H₆FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.14

Ref: 10-F092326