CAS 198206-33-6
:3-(Trifluoromethoxy)iodobenzene
Description:
3-(Trifluoromethoxy)iodobenzene is an organoiodine compound characterized by the presence of an iodine atom and a trifluoromethoxy group (-O-CF3) attached to a benzene ring. This compound typically exhibits a molecular structure where the iodine atom is bonded to the aromatic ring at the meta position relative to the trifluoromethoxy substituent. The trifluoromethoxy group is known for its electron-withdrawing properties, which can influence the reactivity and stability of the compound. 3-(Trifluoromethoxy)iodobenzene is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its unique properties, such as high electronegativity due to the fluorine atoms, can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the presence of iodine can facilitate various coupling reactions, making it a valuable intermediate in synthetic pathways. As with many organoiodine compounds, handling should be done with care due to potential toxicity and environmental concerns associated with iodine and fluorinated compounds.
Formula:C7H4F3IO
InChI:InChI=1/C7H4F3IO/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4H
SMILES:c1cc(cc(c1)OC(F)(F)F)I
Synonyms:- 1-Iodo-3-(Trifluoromethoxy)Benzene
- 3-Iodo-1-(Trifluoromethoxy)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Iodo-3-(trifluoromethoxy)benzene
CAS:Formula:C7H4F3IOPurity:>98.0%(GC)Color and Shape:Colorless to Light red to Green clear liquidMolecular weight:288.01Benzene, 1-iodo-3-(trifluoromethoxy)-
CAS:Formula:C7H4F3IOPurity:97%Color and Shape:LiquidMolecular weight:288.00571-Iodo-3-(trifluoromethoxy)benzene
CAS:1-Iodo-3-(trifluoromethoxy)benzenePurity:97%Color and Shape:LiquidMolecular weight:288.01g/mol3-(Trifluoromethoxy)iodobenzene
CAS:3-(Trifluoromethoxy)iodobenzene is a reagent for organic synthesis that has a high quality and versatile reactivity. It can be used in the preparation of useful scaffolds, which are novel and useful building blocks. 3-(Trifluoromethoxy)iodobenzene is also a useful intermediate for the synthesis of complex compounds. 3-(Trifluoromethoxy)iodobenzene has been shown to have antioxidant properties and can be used as a fine chemical.Formula:C7H4F3IOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:288.01 g/mol3-(Trifluoromethoxy)iodobenzene
CAS:Formula:C7H4F3IOPurity:97%Color and Shape:LiquidMolecular weight:288.008




