CAS 198283-74-8

5-[(2R)-azetidin-2-ylmethoxy]-2-chloropyridine 4-methylbenzenesulfonate

Description:

5-[(2R)-azetidin-2-ylmethoxy]-2-chloropyridine 4-methylbenzenesulfonate, with the CAS number 198283-74-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring, an azetidine moiety, and a sulfonate group. The presence of the azetidine ring suggests potential biological activity, as such structures are often found in pharmaceuticals. The chloropyridine component indicates that the compound may exhibit specific reactivity due to the electron-withdrawing nature of the chlorine atom, which can influence its interaction with biological targets. The sulfonate group enhances the solubility of the compound in polar solvents, making it suitable for various applications, including medicinal chemistry and drug formulation. Additionally, the stereochemistry of the azetidine ring (specifically the (2R) configuration) may play a crucial role in the compound's biological activity and pharmacokinetics. Overall, this compound's unique structural features suggest potential utility in therapeutic contexts, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₆H₁₉ClN₂O₄S

InChI: InChI=1/C9H11ClN2O.C7H8O3S/c10-9-2-1-8(5-12-9)13-6-7-3-4-11-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,5,7,11H,3-4,6H2;2-5H,1H3,(H,8,9,10)/t7-;/m1./s1

Synonyms:

• pyridine, 5-[(2R)-2-azetidinylmethoxy]-2-chloro-, 4-methylbenzenesulfonate (1:1)
• 5-[(2R)-Azetidin-2-ylmethoxy]-2-chloropyridine 4-methylbenzenesulfonate (1:1)
• ABT594(tosylate)
• Tebanicline tosylate

Tebanicline tosylate

CAS: 198283-74-8

Tebanicline: synthetic, potent, non-opioid analgesic, less toxic than epibatidine; relieves neuropathic pain, acts on α3β4 and α4β2 nicotinic receptors.

Formula: C₁₆H₁₉ClN₂O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 370.85

Ref: TM-T3694L