CAS 19829-74-4

4,6-Dihydroxyisophthalic acid

Description:

4,6-Dihydroxyisophthalic acid, with the CAS number 19829-74-4, is an aromatic dicarboxylic acid characterized by the presence of two hydroxyl (-OH) groups and two carboxylic acid (-COOH) groups on a benzene ring. This compound features a symmetrical structure, where the hydroxyl groups are positioned at the 4 and 6 positions relative to the carboxylic acid groups, which are located at the 1 and 3 positions. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols. The presence of hydroxyl groups enhances its reactivity, making it useful in various chemical applications, including the synthesis of polyesters and as a building block in polymer chemistry. Additionally, it exhibits potential for use in the production of high-performance materials due to its ability to form hydrogen bonds, which can improve thermal and mechanical properties. Its applications may extend to the fields of coatings, adhesives, and pharmaceuticals, where its unique chemical properties can be leveraged.

Formula: C₈H₆O₆

InChI: InChI=1S/C8H6O6/c9-5-2-6(10)4(8(13)14)1-3(5)7(11)12/h1-2,9-10H,(H,11,12)(H,13,14)

InChI key: InChIKey=MZGVIIXFGJCRDR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(C(O)=O)=C(O)C=C1O

Synonyms:

• 4,6-Dihydroxyisophthalic acid
• Isophthalic acid, 4,6-dihydroxy-
• 4,6-Dihydroxy-1,3-benzenedicarboxylic acid
• 1,3-Benzenedicarboxylic acid, 4,6-dihydroxy-
• Resorcinol-4,6-dicarboxylic acid

1,3-Benzenedicarboxylic acid, 4,6-dihydroxy-

CAS: 19829-74-4

Formula: C₈H₆O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.1296

Ref: IN-DA002BEZ

4,6-Dihydroxybenzene-1,3-dicarboxylic acid

CAS: 19829-74-4

4,6-Dihydroxybenzene-1,3-dicarboxylic acid

Purity: 99%

Molecular weight: 198.13g/mol

Ref: 54-OR89863

4,6-Dihydroxyisophthalic acid

CAS: 19829-74-4

Formula: C₈H₆O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.13

Ref: 10-F232215