CAS 19830-09-2
:3-Acetyl-3-methylpentane-1,5-dicarboxylic acid
Description:
3-Acetyl-3-methylpentane-1,5-dicarboxylic acid, identified by its CAS number 19830-09-2, is an organic compound characterized by the presence of two carboxylic acid functional groups (-COOH) and an acetyl group (-COCH3) attached to a five-carbon chain. This compound features a branched structure, with a methyl group contributing to its overall stability and reactivity. The dicarboxylic acid nature of this substance allows it to participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Its solubility in polar solvents is typical for dicarboxylic acids, and it may exhibit acidic properties due to the presence of the carboxylic groups. Additionally, the compound's structural features may influence its boiling and melting points, as well as its reactivity with other chemical species. Overall, 3-Acetyl-3-methylpentane-1,5-dicarboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H14O5
InChI:InChI=1/C10H16O5/c1-7(11)10(2,5-3-8(12)13)6-4-9(14)15/h3-6H2,1-2H3,(H,12,13)(H,14,15)/p-2
SMILES:CC(=O)C(C)(CCC(=O)[O-])CCC(=O)[O-]
Synonyms:- 4-Acetyl-4-methylpimelic acid
- 4-Acetyl-4-methylheptanedioic acid
- 4-Acetyl-4-Methylheptanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
