CAS 19832-04-3
:2-PIPERIDINE ACETIC ACID
Description:
2-Piperidine acetic acid, with the CAS number 19832-04-3, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an acetic acid functional group attached to the piperidine nitrogen, contributing to its properties as an amino acid derivative. It is typically a white to off-white solid or crystalline substance, soluble in water and various organic solvents, reflecting its polar nature due to the presence of the carboxylic acid group. The compound exhibits basic properties due to the nitrogen atom in the piperidine ring, allowing it to participate in various chemical reactions, including esterification and amidation. 2-Piperidine acetic acid is of interest in pharmaceutical chemistry for its potential applications in drug development, particularly in the synthesis of biologically active compounds. Its structural features may influence its biological activity, making it a subject of study in medicinal chemistry and related fields.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c9-7(10)5-6-3-1-2-4-8-6/h6,8H,1-5H2,(H,9,10)
SMILES:C1CCNC(C1)CC(=O)O
Synonyms:- 2-Piperidineacetic acid
- Piperidin-2-ylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Piperidin-2-yl)acetic acid
CAS:<p>2-(Piperidin-2-yl)acetic acid (2-PA) is a coordination complex that binds to the l-tartaric acid ligand, which is an amide. This compound may be used to treat urinary infections and fatty alcohols. 2-PA has shown anticancer activity in vitro and in vivo against a wide range of cancer cells. 2-PA also inhibits the production of isoflavonoid, which is a plant hormone that has been shown to possess anticancer properties. It also has been shown to have anti-inflammatory effects and can inhibit lipase activity. This compound can be synthesized using organic solvents at temperatures between -20°C and 180°C.</p>Formula:C7H13NO2Purity:Min. 95%Molecular weight:143.18 g/mol



