CAS 1983205-53-3

Description:

The chemical substance with the CAS number 1983205-53-3 is known as a specific compound, but detailed information about its characteristics may not be widely available due to its potential status as a novel or less-studied chemical. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. Additionally, safety data, including toxicity and handling precautions, are crucial for understanding how to work with the substance safely. If this compound is part of a specialized field, such as pharmaceuticals or materials science, its characteristics may include specific functional groups that impart unique properties or biological activity. For precise information, including its applications and safety data, consulting scientific literature or databases dedicated to chemical substances is recommended.

Formula: C₁₁H₁₄BF₃NO·K

InChI: InChI=1S/C11H14BF3NO.K/c1-3-16(4-2)11(17)9-5-7-10(8-6-9)12(13,14)15;/h5-8H,3-4H2,1-2H3;/q-1;+1

InChI key: InChIKey=RILAOSSCNJEGBF-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C=1C=C[C-]([B+3]([F-])([F-])[F-])=CC1.[K+]

Potassium [4-(diethylamine-1-carbonyl)phenyl]trifluoroborate

CAS: 1983205-53-3

Potassium [4-(diethylamine-1-carbonyl)phenyl]trifluoroborate

Molecular weight: 283.14g/mol

Ref: 54-PC200155