CAS 19833-12-6
:Myricetin 3-O-glucoside
Description:
Myricetin 3-O-glucoside is a flavonoid glycoside, a type of compound commonly found in various plants, particularly in fruits, vegetables, and herbs. It is characterized by its structure, which consists of the flavonoid myricetin linked to a glucose molecule at the 3-position. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in nutritional and pharmaceutical research. Myricetin 3-O-glucoside is soluble in water and organic solvents, which facilitates its absorption and bioavailability in biological systems. Its presence in dietary sources contributes to the health benefits associated with flavonoid-rich diets. Additionally, it may play a role in plant defense mechanisms against pathogens and environmental stressors. The compound is often studied for its potential therapeutic applications, particularly in the context of chronic diseases linked to oxidative stress and inflammation. Overall, Myricetin 3-O-glucoside represents a significant area of interest in both natural product chemistry and health sciences.
Formula:C21H20O13
InChI:InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15-,17+,18-,21+/m1/s1
InChI key:InChIKey=FOHXFLPXBUAOJM-LIBJPBHASA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C(O)=C3)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-
- Myricetin 3-O-glucoside
- Myricetin 3-glucoside
- Isomyricitrin
- Myricetin 3-β-Glucoside
- Myricetin 3-β-D-glucopyranoside
- Myricetin 3-O-glucopyranoside
- -Glucoside
- 3-[(β-D-Glucopyranosyl)oxy]-3',4',5,5',7-pentahydroxyflavone
- iso-Myricitrin
- 3-O-beta-D-Galatopyranoside-Myricetin
- Myricetin 3-O-β-D-glucopyranoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Myricetin-3-O-glucoside
CAS:Myricetin-3-O-glucoside analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H20O13Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:480.38Myricetin 3-O-glucoside
CAS:Myricetin 3-O-glucoside from Tibouchina paratropica has anti-leishmania, anti-inflammatory, and antibacterial properties.Formula:C21H20O13Purity:99.7%Color and Shape:SolidMolecular weight:480.38Myricetin 3-β-glucoside
CAS:Myricetin 3-β-glucoside is a flavonoid glucoside, which is a naturally occurring compound found in various fruits, vegetables, and herbs such as Myrica rubra. As a derivative of myricetin, it belongs to the class of polyphenolic compounds known for their potent biological activities. The compound functions primarily as an antioxidant, scavenging free radicals and thereby protecting cellular components from oxidative damage. In this role, it interrupts oxidative stress pathways that contribute to cellular aging and degenerative diseases.
Formula:C21H20O13Purity:Min. 95%Color and Shape:PowderMolecular weight:480.4 g/molMyricetin 3-β-Glucoside
CAS:Controlled ProductFormula:C22H22O12Color and Shape:NeatMolecular weight:478.403





