CAS 19833-25-1
:Patulitrin
Description:
Patulitrin, with the CAS number 19833-25-1, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain plant species and is known for its potential biological activities. Patulitrin exhibits characteristics typical of alkaloids, including a complex structure that often contains nitrogen atoms, which contribute to its pharmacological properties. This compound has been studied for its potential therapeutic effects, including anti-inflammatory and analgesic activities. Additionally, patulitrin may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many alkaloids, safety and toxicity profiles are important considerations in its use and application. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in medicine and agriculture.
Formula:C22H22O13
InChI:InChI=1/C22H22O13/c1-32-21-11(34-22-19(31)17(29)14(26)12(6-23)35-22)5-10-13(16(21)28)15(27)18(30)20(33-10)7-2-3-8(24)9(25)4-7/h2-5,12,14,17,19,22-26,28-31H,6H2,1H3/t12-,14-,17+,19-,22-/m0/s1
InChI key:InChIKey=AFCDXKGLUDDXCK-LMTLLXHESA-N
SMILES:OC1=C2C(OC(=C(O)C2=O)C3=CC(O)=C(O)C=C3)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=C1OC
Synonyms:- 2-(3,4-Dihydroxyphenyl)-7-(beta-D-glucopyranosyloxy)-3,5-dihydroxy-6-methoxy-4H-1-benzopyran-4-one
- 2-(3,4-Dihydroxyphenyl)-7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5-dihydroxy-6-methoxy-4H-1-benzopyran-4-one
- 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-6-methoxy-4-oxo-4H-chromen-7-yl beta-L-glucopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5-dihydroxy-6-methoxy-
- 6-Methoxyquercetin 7-O-glucoside
- 6-Methoxyquercetin 7-glucoside
- Patuletin 7-O-glucoside
- Patuletin 7-glucoside
- Patuletin 7-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Patulitrin
- 2-(3,4-Dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-3,5-dihydroxy-6-methoxy-4H-1-benzopyran-4-one
- Patuletin 7-β-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-3,5-dihydroxy-6-methoxy-
- Einecs 243-356-4
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Patulitrin
CAS:Patulitrin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C22H22O13Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:494.41Patulitrin
CAS:Patulitrin: antioxidant, anti-inflammatory, larvicidal, reduces acute inflammation in mice orally/topically.Formula:C22H22O13Purity:98%Color and Shape:SolidMolecular weight:494.4Patuletin-7-O-glucoside
CAS:Patuletin-7-O-glucoside is a naturally occurring flavonoid glycoside, which is primarily extracted from various plant species, such as marigolds or other members of the Asteraceae family. The glycosidic linkage involves the attachment of a glucose moiety to the patuletin aglycone at the 7th position. This compound acts primarily through antioxidant mechanisms, where it scavenges free radicals and mitigates oxidative stress, which is critical in reducing cellular damage caused by reactive oxygen species.Formula:C22H22O13Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:494.4 g/mol


