CymitQuimica logo

CAS 19833-82-0

:

2-hydroxy-5-methoxy-3-tridecylcyclohexa-2,5-diene-1,4-dione

Description:
2-Hydroxy-5-methoxy-3-tridecylcyclohexa-2,5-diene-1,4-dione, with the CAS number 19833-82-0, is a chemical compound that features a cyclohexadiene structure with multiple functional groups. This compound is characterized by the presence of a hydroxyl group (-OH) and a methoxy group (-OCH3), which contribute to its reactivity and solubility properties. The tridecyl chain indicates a long aliphatic hydrocarbon tail, which can influence its hydrophobic characteristics and potential applications in various fields, such as surfactants or emulsifiers. The dione functionality suggests the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Overall, this compound's unique structure may impart specific biological activities or chemical properties, making it of interest in medicinal chemistry or materials science. Further studies would be necessary to fully elucidate its potential applications and biological effects.
Formula:C20H32O4
InChI:InChI=1/C20H32O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-16-19(22)17(21)15-18(24-2)20(16)23/h15,22H,3-14H2,1-2H3
SMILES:CCCCCCCCCCCCCC1=C(C(=O)C=C(C1=O)OC)O
Synonyms:
  • 2,5-Cyclohexadiene-1,4-dione, 2-hydroxy-5-methoxy-3-tridecyl-
  • 2-Hydroxy-5-methoxy-3-tridecyl-1,4-benzoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.