CymitQuimica logo

CAS 198334-39-3

:

Piperidine, 4-(2-naphthalenyl)-, hydrochloride (1:1)

Description:
Piperidine, 4-(2-naphthalenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-naphthalenyl group indicates that a naphthalene moiety is attached to the piperidine at the 4-position, contributing to its aromatic properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, and it may be used in the synthesis of various pharmaceuticals or as a research chemical. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, highlighting the importance of structural features in determining chemical behavior and potential uses.
Formula:C15H17N·ClH
InChI:InChI=1S/C15H17N.ClH/c1-2-4-14-11-15(6-5-12(14)3-1)13-7-9-16-10-8-13;/h1-6,11,13,16H,7-10H2;1H
InChI key:InChIKey=IRDSROWCEHZHKY-UHFFFAOYSA-N
SMILES:C1(=CC2=C(C=C1)C=CC=C2)C3CCNCC3.Cl
Synonyms:
  • Piperidine, 4-(2-naphthalenyl)-, hydrochloride (1:1)
  • Piperidine, 4-(2-naphthalenyl)-, hydrochloride
  • 4-(2-Naphthyl)piperidine hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.