CAS 198348-89-9
:5-nitro-3-pyrazolecarboxylic acid
Description:
5-Nitro-3-pyrazolecarboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a nitro group (-NO2) at the 5-position and a carboxylic acid group (-COOH) at the 3-position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its nitro group can participate in electrophilic substitution reactions, while the carboxylic acid can engage in acid-base reactions. The compound may also display biological activity, making it of interest in pharmaceutical research. Additionally, its unique structure allows for potential use in the synthesis of other complex molecules. Safety data should be consulted for handling, as nitro compounds can be sensitive and require appropriate precautions. Overall, 5-nitro-3-pyrazolecarboxylic acid is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C4H2N3O4
InChI:InChI=1/C4H3N3O4/c8-4(9)2-1-3(6-5-2)7(10)11/h1H,(H,5,6)(H,8,9)/p-1
SMILES:c1c(C(=O)[O-])[nH]nc1N(=O)=O
Synonyms:- Tris(Isopropylcyclopentadienyl)Terbium
- 5-Nitro-3-Pyrazolecarboxylci Acid
- 3-nitro-1H-pyrazole-5-carboxylic acid
- 3-nitro-1H-pyrazole-5-carboxylate
- 5-Nitro-1H-Pyrazole-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Pyrazole-3-carboxylic acid, 5-nitro-
CAS:Formula:C4H3N3O4Purity:98%Color and Shape:SolidMolecular weight:157.08435-Nitro-1H-pyrazole-3-carboxylic acid
CAS:5-Nitro-1H-pyrazole-3-carboxylic acidFormula:C4H3N3O4Purity:98%Color and Shape: slightly yellow solidMolecular weight:157.08g/mol5-Nitro-3-pyrazolecarboxylic acid
CAS:Formula:C4H3N3O4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:157.085-Nitro-3-pyrazolecarboxylic acid
CAS:5-Nitro-3-pyrazolecarboxylic acid is a lead compound that has been shown to induce transcription of the gene encoding for the transcription factor, PPARγ. This molecule has also been shown to have anti-cancer and anti-diabetic properties in cellular and animal models. 5-Nitro-3-pyrazolecarboxylic acid has been observed to interact with other molecules by bonding to them or inhibiting their function. These interactions may be responsible for some of its diverse effects on metabolic disease, cancer, and transcription factors.Formula:C4H3N3O4Purity:Min. 95%Color and Shape:PowderMolecular weight:157.08 g/mol5-Nitro-1H-pyrazole-3-carboxylic acid
CAS:Formula:C4H3N3O4Purity:95%Color and Shape:SolidMolecular weight:157.085




