CAS 19835-38-2

1-adamantaneacetyl chloride

Description:

1-Adamantaneacetyl chloride, with the CAS number 19835-38-2, is an acyl chloride derivative of adamantane, a polycyclic hydrocarbon known for its unique cage-like structure. This compound features an acetyl group (-COCH3) attached to the adamantane framework, which contributes to its reactivity and utility in organic synthesis. As an acyl chloride, it is characterized by its ability to undergo nucleophilic acyl substitution reactions, making it a valuable intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. The presence of the adamantane structure imparts notable stability and steric hindrance, influencing its reactivity profile. Typically, 1-adamantaneacetyl chloride is a colorless to pale yellow liquid or solid, depending on temperature and purity, and it is known to be corrosive and reactive with water, releasing hydrochloric acid upon hydrolysis. Proper handling and storage in a controlled environment are essential due to its potential hazards.

Formula: C₁₂H₁₇ClO

InChI: InChI=1/C12H17ClO/c13-11(14)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2

SMILES: C1C2CC3CC1CC(C2)(C3)CC(=O)Cl

Synonyms:

• 1-Adamantylacetyl Chloride
• 2-(1-Adamantyl)Ethanoyl Chloride
• Adamantan-1-Yl-Acetyl Chloride
• Akos Bc-0495
• Tricyclo[3.3.1.1~3,7~]Dec-1-Ylacetyl Chloride

Tricyclo[3.3.1.13,7]decane-1-acetyl chloride

CAS: 19835-38-2

Formula: C₁₂H₁₇ClO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 212.7158

Ref: IN-DA002BGN

1-Adamantylacetyl chloride

CAS: 19835-38-2

1-Adamantylacetyl chloride

Purity: 95%

Molecular weight: 212.72g/mol

Ref: 54-OR1003363

1-ADAMANTANEACETYL CHLORIDE

CAS: 19835-38-2

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 212.72000122070312

Ref: 10-F386859

1-Adamantylacetyl chloride

CAS: 19835-38-2

1-Adamantylacetyl chloride is a hydroxylamine that can be used in medicinal chemistry as a synthon for enamines. It is also a potential target for pharmaceutical research due to its ability to form cyclic chlorides. 1-Adamantylacetyl chloride can be synthesized from malonate and anhydrous hydrochloric acid, with the addition of an appropriate chloride such as trifluoromethyl or bromomethyl. The resulting product can be used to produce ketones by reacting with acetone or methyl ethyl ketone.

Formula: C₁₂H₁₇ClO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 212.72 g/mol

Ref: 3D-FA67148