CAS 1984-15-2: Methylenediphosphonic acid
Description:Methylenediphosphonic acid, with the CAS number 1984-15-2, is an organophosphorus compound characterized by the presence of two phosphonic acid groups (-PO3H2) linked by a methylene bridge (-CH2-). This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and exhibits strong acidity due to the presence of the phosphonic acid groups, which can donate protons in solution. Methylenediphosphonic acid is known for its chelating properties, allowing it to form stable complexes with metal ions, making it useful in various applications, including water treatment, scale inhibition, and as a corrosion inhibitor. Additionally, it has potential applications in agriculture as a plant growth regulator and in the synthesis of other phosphorus-containing compounds. Its stability and reactivity make it a valuable compound in both industrial and research settings. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:CH6O6P2
InChI:InChI=1S/CH6O6P2/c2-8(3,4)1-9(5,6)7/h1H2,(H2,2,3,4)(H2,5,6,7)
InChI key:InChIKey=MBKDYNNUVRNNRF-UHFFFAOYSA-N
SMILES:O=P(O)(O)CP(=O)(O)O
- Synonyms:
- (Phosphonomethyl)phosphonic acid
- MDP
- Medronate
- Methane-1,1-diphosphonic acid
- Methanebisphosphonic acid
- Methanediphosphonic acid
- Methanediylbis(Phosphonic Acid)
- Methylene diphosphonate
- Methylene-1,1-bisphosphonic acid
- Methylenebis[phosphonic acid]
- See more synonyms
- Methylenediphosphonic acid
- P,P′-Methylenebis[phosphonic acid]
- Phosphonic acid, P,P′-methylenebis-
- Phosphonic acid, methylenebis-
- Phosphonic acid,methylenedi-
