CAS 1984-19-6
:2-Isocyanopyridine
Description:
2-Isocyanopyridine is an organic compound characterized by its isocyanate functional group attached to a pyridine ring. It is a colorless to pale yellow liquid with a distinctive odor. The molecular formula of 2-isocyanopyridine is C6H4N2O, and it has a relatively low boiling point, making it volatile. This compound is known for its reactivity, particularly in forming stable urea derivatives when it reacts with amines. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the isocyanate group contributes to its potential toxicity, necessitating careful handling and storage. Additionally, 2-isocyanopyridine can participate in various chemical reactions, including nucleophilic addition and cycloaddition, making it a valuable building block in synthetic chemistry. Its unique properties and reactivity profile make it a subject of interest in both academic research and industrial applications.
Formula:C6H4N2
InChI:InChI=1S/C6H4N2/c1-7-6-4-2-3-5-8-6/h2-5H
InChI key:InChIKey=KSQAFIWDAONOFL-UHFFFAOYSA-N
SMILES:[N+](#[C-])C1=CC=CC=N1
Synonyms:- Pyridine, 2-isocyano-
- 2-Pyridyl isocyanide
- 2-Isocyanopyridine
- 2-Pyridinylisonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

