CymitQuimica logo

CAS 19842-76-3

:

2,3,5,6-Tetrafluorobenzaldehyde

Description:
2,3,5,6-Tetrafluorobenzaldehyde is an aromatic aldehyde characterized by the presence of four fluorine atoms substituted on a benzene ring. The molecular formula for this compound is C7H2F4O, indicating a relatively low hydrogen content due to the fluorine substitutions. It typically appears as a colorless to pale yellow liquid with a distinct odor. The presence of fluorine atoms enhances its reactivity and polarity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals and agrochemicals. The compound is known for its relatively low boiling point and moderate solubility in organic solvents. Additionally, 2,3,5,6-Tetrafluorobenzaldehyde can participate in electrophilic aromatic substitution reactions and can undergo further transformations, such as reduction to yield corresponding alcohols or condensation reactions to form more complex structures. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C7H2F4O
InChI:InChI=1S/C7H2F4O/c8-4-1-5(9)7(11)3(2-12)6(4)10/h1-2H
InChI key:YIRYOMXPMOLQSO-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=C1F)F)C=O)F)F
Found 5 products.