CymitQuimica logo

CAS 198422-11-6

:

(2S)-2-Amino-N-[2-(dimethylamino)ethyl]-3,3-dimethylbutanamide

Description:
(2S)-2-Amino-N-[2-(dimethylamino)ethyl]-3,3-dimethylbutanamide, with CAS number 198422-11-6, is a chemical compound characterized by its amino group and a dimethylamino substituent. This compound features a chiral center at the second carbon, indicating that it exists in a specific stereoisomeric form, which is crucial for its biological activity. The presence of the dimethylamino group suggests potential interactions with biological receptors, making it of interest in pharmaceutical applications. The structure includes a branched aliphatic chain, contributing to its hydrophobic characteristics, while the amino group enhances its solubility in polar solvents. This compound may exhibit properties typical of amides, such as stability under various conditions and the ability to participate in hydrogen bonding. Its specific stereochemistry and functional groups can influence its reactivity and interaction with other molecules, making it relevant in medicinal chemistry and drug design. Overall, this compound's unique structure and functional groups position it as a candidate for further research in various chemical and biological contexts.
Formula:C10H23N3O
InChI:InChI=1S/C10H23N3O/c1-10(2,3)8(11)9(14)12-6-7-13(4)5/h8H,6-7,11H2,1-5H3,(H,12,14)/t8-/m1/s1
InChI key:InChIKey=REYOFKPDVUAABY-MRVPVSSYSA-N
SMILES:C([C@H](C(C)(C)C)N)(NCCN(C)C)=O
Synonyms:
  • (2S)-2-Amino-N-[2-(dimethylamino)ethyl]-3,3-dimethylbutanamide
  • Butanamide, 2-amino-N-[2-(dimethylamino)ethyl]-3,3-dimethyl-, (S)-
  • Butanamide, 2-amino-N-[2-(dimethylamino)ethyl]-3,3-dimethyl-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.