CymitQuimica logo

CAS 198471-06-6

:

N-((4-(5-Methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)acetaMide

Description:
N-((4-(5-Methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)acetamide, identified by its CAS number 198471-06-6, is a chemical compound characterized by its complex structure, which includes an isoxazole ring and a sulfonamide functional group. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary. The presence of the isoxazole moiety suggests it may also have applications in medicinal chemistry, potentially acting as a scaffold for drug development. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the presence of multiple aromatic rings may contribute to its electronic properties, affecting its reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C18H16N2O4S
InChI:InChI=1S/C18H16N2O4S/c1-12-17(18(19-24-12)15-6-4-3-5-7-15)14-8-10-16(11-9-14)25(22,23)20-13(2)21/h3-11H,1-2H3,(H,20,21)
InChI key:UMBILIGVYYXBRD-UHFFFAOYSA-N
SMILES:CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)NC(=O)C
Found 6 products.