CymitQuimica logo

CAS 198474-06-5

:

5-Fluoro-3-(3-pyrrolidinyl)-1H-indole

Description:
5-Fluoro-3-(3-pyrrolidinyl)-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and a pyrrolidine group at the 3-position contributes to its unique properties. This compound is often studied for its potential biological activities, particularly in the field of medicinal chemistry, where it may exhibit effects on neurotransmitter systems or serve as a scaffold for drug development. Its molecular structure suggests it may interact with various biological targets, making it of interest in pharmacological research. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in various analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H13FN2
InChI:InChI=1S/C12H13FN2/c13-9-1-2-12-10(5-9)11(7-15-12)8-3-4-14-6-8/h1-2,5,7-8,14-15H,3-4,6H2
InChI key:InChIKey=ZWQBLJKCRPTUSP-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=CNC2=CC1)C3CCNC3
Synonyms:
  • 5-Fluoro-3-(3-pyrrolidinyl)-1H-indole
  • 1H-Indole, 5-fluoro-3-(3-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.