CAS 1985-37-1

1-phenyl-2,3-naphthalenedicarboxylic anhydride

Description:

1-Phenyl-2,3-naphthalenedicarboxylic anhydride, with the CAS number 1985-37-1, is an organic compound characterized by its anhydride functional group derived from naphthalene. This compound features a naphthalene backbone with two carboxylic acid groups that have undergone dehydration to form an anhydride. It typically appears as a solid, often crystalline, substance and is known for its stability under standard conditions. The presence of the phenyl group enhances its aromatic character, contributing to its potential applications in organic synthesis and materials science. This compound can participate in various chemical reactions, including nucleophilic acyl substitution, making it useful in the synthesis of more complex organic molecules. Additionally, it may exhibit properties such as moderate solubility in organic solvents and potential reactivity with nucleophiles, which can be exploited in polymer chemistry and the development of functional materials. Safety precautions should be observed when handling this compound, as with many anhydrides, due to potential irritant properties.

Formula: C₁₈H₁₀O₃

InChI: InChI=1/C18H10O3/c19-17-14-10-12-8-4-5-9-13(12)15(16(14)18(20)21-17)11-6-2-1-3-7-11/h1-10H

SMILES: c1ccc(cc1)c1c2ccccc2cc2c1C(=O)OC2=O

Synonyms:

• 4-Phenylnaphtho[2,3-C]Furan-1,3-Dione

Naphtho[2,3-c]furan-1,3-dione, 4-phenyl-

CAS: 1985-37-1

Formula: C₁₈H₁₀O₃

Molecular weight: 274.2702

Ref: IN-DA002BKV

1-Phenyl-2,3-naphthalenedicarboxylic anhydride

CAS: 1985-37-1

Formula: C₁₈H₁₀O₃

Molecular weight: 274.27

Ref: 7W-GT0362

1-Phenyl-2,3-naphthalenedicarboxylic anhydride

CAS: 1985-37-1

1-Phenyl-2,3-naphthalenedicarboxylic anhydride is a dicarboxylic acid with the formula (CHCO)O. It can be obtained by radical cyclization of the corresponding lactone, which yields xylene and a carbenes. The phenyl groups of this compound are cinnamyl for the cis isomer and benzoyl for the trans isomer. In addition to these two isomers, there are two more stereoisomers that can form from the elimination of water in acidic conditions: trichloroacetic acid and aluminium hydroxide. The cis and trans forms are catalytic with respect to each other and their reactions yield diastereomers with different substituents on the phenyl group. These compounds have been used as substrates for trichloroacetic acid catalyzed eliminations, giving aryl substituted acetic acids. The cis-dimer has also

Formula: C₁₈H₁₀O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 274.3 g/mol

Ref: 3D-BAA98537