CAS 19851-61-7
:1,4-Bis(phenylmethyl) 1,4-benzenedicarboxylate
Description:
1,4-Bis(phenylmethyl) 1,4-benzenedicarboxylate, with the CAS number 19851-61-7, is an organic compound characterized by its structure, which features two phenylmethyl groups attached to a central 1,4-benzenedicarboxylate moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in materials science, particularly in the development of polymers and as a building block in organic synthesis. It exhibits good thermal stability and solubility in organic solvents, making it suitable for various chemical reactions and processes. The presence of carboxylate groups contributes to its reactivity, allowing for further functionalization. Additionally, the phenylmethyl substituents can influence the compound's electronic properties and interactions with other molecules. Overall, 1,4-Bis(phenylmethyl) 1,4-benzenedicarboxylate is of interest in both academic research and industrial applications due to its unique structural features and chemical behavior.
Formula:C22H18O4
InChI:InChI=1S/C22H18O4/c23-21(25-15-17-7-3-1-4-8-17)19-11-13-20(14-12-19)22(24)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2
InChI key:InChIKey=IWGFEQWCMAADJZ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2=CC=C(C(OCC3=CC=CC=C3)=O)C=C2
Synonyms:- 1,4-Benzendicarboxylic acid bis(phenyl methyl) ester
- 1,4-Benzenedicarboxylic acid, 1,4-bis(phenylmethyl) ester
- 1,4-Benzenedicarboxylic acid, bis(phenylmethyl) ester
- 1,4-Bis(phenylmethyl) 1,4-benzenedicarboxylate
- Dibenzyl Benzene-1,4-Dicarboxylate
- Terephthalic acid, dibenzyl ester
- Dibenzyl terephthalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,4-Benzenedicarboxylic acid, 1,4-bis(phenylmethyl) ester
CAS:Formula:C22H18O4Purity:95%Color and Shape:SolidMolecular weight:346.3759Dibenzyl Terephthalate
CAS:Controlled ProductApplications Dibenzyl terephthalate is used in the synthesis of Pharacine (P294550), which is a natural p-cyclophane from the bacterial strain Cytophaga sp. AM13.1. Pharacine is a poly(butylene terephthalate) dimer.
References Shaaban, M. et al.: J. Nat. Prod., 65, 1660 (2002); East, G.C. et al.: Polymer, 23, 323 (1982);Formula:C22H18O4Color and Shape:NeatMolecular weight:346.38Terephthalic acid dibenzyl ester
CAS:Terephthalic acid dibenzyl ester is a reactive dye that changes color when it reacts with metals. It is used in the preparation of polyvinyl chloride (PVC) and other polymers. Terephthalic acid dibenzyl ester has a low energy, which means that it does not emit much heat or light when heated or exposed to light. This property makes it useful for recording devices such as thermometers and recorders. The hydroxyl group on the aromatic hydrocarbon allows this compound to react with unsaturated alkyls, which are compounds containing carbon-to-carbon double bonds. Terephthalic acid dibenzyl ester has been shown to increase insulin sensitivity in rats by increasing glucose uptake into skeletal muscle cells.Formula:C22H18O4Purity:Min. 95%Color and Shape:PowderMolecular weight:346.38 g/mol



