CAS 198560-10-0
:FMOC-HOMO-L-TYROSINE
Description:
FMOC-HOMO-L-Tyrosine, with the CAS number 198560-10-0, is a derivative of the amino acid tyrosine, modified with a 9-fluorenylmethoxycarbonyl (FMOC) protecting group. This compound is characterized by its ability to serve as a building block in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS). The FMOC group provides a stable protection for the amino group, allowing for selective deprotection under mild basic conditions, which is advantageous in multi-step synthesis. The "HOMO" designation indicates that it contains a homophenylalanine structure, which contributes to its unique properties, such as increased hydrophobicity and potential for enhanced biological activity. FMOC-HOMO-L-Tyrosine is typically used in research and development for the synthesis of peptides that may have applications in pharmaceuticals, biochemistry, and molecular biology. Its solubility in organic solvents and stability under various conditions make it a valuable compound in synthetic chemistry.
Formula:C25H23NO5
InChI:InChI=1/C25H23NO5/c27-17-12-9-16(10-13-17)11-14-23(24(28)29)26-25(30)31-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22-23,27H,11,14-15H2,(H,26,30)(H,28,29)/t23-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](CCc1ccc(cc1)O)C(=O)O)O
Synonyms:- (S)-N-Alpha-(9-Fluorenylmethoxycarbonyl)-2-Amino-4-Hydroxybenzenebutanoic Acid
- (S)-2-(9H-Fluoren-9-Ylmethoxycarbonylamino)-4-(4-Hydroxy-Phenyl)-Butyric Acid
- N-Alpha-(9-Fluorenylmethyloxycarbonyl)-L-Homo-Tyrosine
- Fmoc-Tyr(Noch2)-Oh
- Fmoc-Homotyr-Oh
- Fmoc-Homo-Tyrosine
- Fmoc-Hty-Oh
- (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-hydroxyphenyl)butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-hydroxyphenyl)butanoic acid
CAS:(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-hydroxyphenyl)butanoic acidPurity:98%Molecular weight:417.46g/molFmoc-L-homotyrosine
CAS:<p>Fmoc-L-homotyrosine is a tyrosine kinase inhibitor. Tyrosine kinases are enzymes that catalyze the transfer of phosphate groups from ATP to tyrosine residues in proteins, which play a role in many cellular processes. Fmoc-L-homotyrosine binds to the ATP binding site in the active site of these enzymes, preventing phosphorylation and thus preventing protein function. This compound has been shown to inhibit neurotensin receptors in vitro and has also been shown to be an endogenous ligand for this receptor. Fmoc-L-homotyrosine binds to allosteric sites on the neurotensin receptor, causing conformational changes that activate transduction pathways and increase signaling. The mechanism of inhibition is not yet fully understood but is thought to be due to steric hindrance or allosteric binding.</p>Formula:C25H23NO5Purity:Min. 95%Molecular weight:417.45 g/mol
