CAS 1986-15-8
:L-Guluronic acid
Description:
L-Guluronic acid is a naturally occurring uronic acid, which is a type of sugar acid derived from the oxidation of sugars. It is a component of certain polysaccharides, particularly in alginates, which are found in brown seaweeds. L-Guluronic acid is characterized by its six-carbon structure, featuring a carboxylic acid group that contributes to its acidic properties. This compound plays a significant role in the formation of gel-like structures in various biological and industrial applications. It is known for its ability to form stable gels in the presence of divalent cations, such as calcium ions, which is crucial for its use in food and pharmaceutical industries. Additionally, L-Guluronic acid exhibits various biological activities, including potential antioxidant properties. Its solubility in water and compatibility with other polysaccharides make it a valuable ingredient in formulations aimed at enhancing texture and stability. Overall, L-Guluronic acid is an important compound with diverse applications in food science, biotechnology, and medicine.
Formula:C6H10O7
InChI:InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3-,4+,5-/m1/s1
InChI key:InChIKey=IAJILQKETJEXLJ-SQOUGZDYSA-N
SMILES:[C@H]([C@@H]([C@@H](C=O)O)O)([C@H](C(O)=O)O)O
Synonyms:- Guluronic acid, L-
- L-Guluronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
