CymitQuimica logo

CAS 198625-33-1

:

6-(2,5-Dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-1H-inden-1-one

Description:
6-(2,5-Dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-1H-inden-1-one, with the CAS number 198625-33-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an indene core fused with various functional groups. This compound features a benzoyl moiety and hydroxyl groups, contributing to its potential reactivity and solubility properties. The presence of the quinoline derivative suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The dimethyl substitution on the benzoyl group may influence its electronic properties and steric hindrance, affecting its interactions in biological systems. Additionally, the compound's structural features may allow for various synthetic modifications, making it a versatile candidate for further research in organic synthesis and drug development. Its stability, solubility, and reactivity would depend on the specific conditions of use, including solvent choice and temperature.
Formula:C27H19NO4
InChI:InChI=1S/C27H19NO4/c1-14-7-8-15(2)19(11-14)25(30)17-9-10-18-20(12-17)27(32)23(26(18)31)24-22(29)13-16-5-3-4-6-21(16)28-24/h3-13,29,31H,1-2H3
InChI key:InChIKey=PGAAWVKSUVQIOT-UHFFFAOYSA-N
SMILES:O=C1C(=C(O)C=2C1=CC(C(=O)C3=C(C)C=CC(C)=C3)=CC2)C4=NC5=C(C=C4O)C=CC=C5
Synonyms:
  • 6-(2,5-Dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-1H-inden-1-one
  • 1H-Inden-1-one, 6-(2,5-dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.