CAS 19863-69-5
:(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methanaminium chloride
Description:
(5-Methyl-2,3-dihydro-1-benzofuran-2-yl)methanaminium chloride, with the CAS number 19863-69-5, is a chemical compound characterized by its unique structure that includes a benzofuran moiety and a methanaminium group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the quaternary ammonium ion, which enhances its hydrophilicity. The presence of the methyl group on the benzofuran ring can influence its biological activity and solubility properties. As a quaternary ammonium salt, it may exhibit cationic surfactant properties, making it useful in various applications, including pharmaceuticals and as a potential antimicrobial agent. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, its unique structural features and properties make it a subject of interest in both synthetic chemistry and medicinal research.
Formula:C10H14ClNO
InChI:InChI=1/C10H13NO.ClH/c1-7-2-3-10-8(4-7)5-9(6-11)12-10;/h2-4,9H,5-6,11H2,1H3;1H
SMILES:Cc1ccc2c(c1)CC(CN)O2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.