CAS 19865-87-3
:Cabralealactone
Description:
Cabralealactone, with the CAS number 19865-87-3, is a naturally occurring chemical compound classified as a lactone, which is a cyclic ester formed from the condensation of an alcohol and a carboxylic acid. This compound is primarily derived from certain plant sources, particularly within the family of Asteraceae. Cabralealactone is characterized by its unique structural features, including a specific arrangement of carbon, hydrogen, and oxygen atoms that contribute to its chemical reactivity and potential biological activity. It has been studied for its potential applications in various fields, including pharmaceuticals and perfumery, due to its distinctive aroma and possible therapeutic properties. Additionally, like many lactones, cabralealactone may exhibit interesting interactions with biological systems, making it a subject of interest in natural product chemistry and medicinal research. Its stability, solubility, and reactivity can vary depending on environmental conditions, which are important factors to consider in its application and study.
Formula:C27H42O3
InChI:InChI=1S/C27H42O3/c1-23(2)19-10-15-26(5)20(24(19,3)13-11-21(23)28)8-7-17-18(9-14-25(17,26)4)27(6)16-12-22(29)30-27/h17-20H,7-16H2,1-6H3/t17-,18+,19+,20-,24+,25-,26-,27+/m1/s1
InChI key:InChIKey=NOLGXQBEFHYZHI-QPBHWVAKSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)C(=O)CC3)[H])(CC[C@]4([C@@]2(C)CC[C@@]4([C@@]5(C)OC(=O)CC5)[H])[H])[H]
Synonyms:- Tris(norketo)lactone II
- 18-Nor-5α-cholanic acid, 20-hydroxy-4,4,8,14-tetramethyl-3-oxo-, γ-lactone
- 18-Nor-5α-cholan-24-oic acid, 20-hydroxy-4,4,8,14-tetramethyl-3-oxo-, γ-lactone, (20S)-
- 18-Norcholan-24-oic acid, 20-hydroxy-4,4,8,14-tetramethyl-3-oxo-, γ-lactone, (5α)-
- Cabralealactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cabralealactone
CAS:Cabralealactone: Antimycobacterial, weakly cytotoxic to BC cells, moderately active vs. NCI-H187 lung cancer.Formula:C27H42O3Color and Shape:SolidMolecular weight:414.62Cabralealactone
CAS:Controlled ProductCabralealactone is a novel natural product that has been shown to have potent anti-inflammatory activity. Cabralealactone binds to p-hydroxybenzoic acid, a lipid metabolite produced by the body, and inhibits tumor necrosis factor-α (TNF-α) production. Cabralealactone has also been shown to inhibit the spread of herpes simplex virus type 1 in cell culture. The chemical structure of cabralealactone is similar to that of meliaceae and cabrala hydroxyacetate, which possess hepatoprotective activity. This compound was isolated from the genus Cabralea, which belongs to the Meliaceae family.Formula:C27H42O3Purity:Min. 95%Molecular weight:414.6 g/mol



