
CAS 198710-92-8
:(-)-Kaitocephalin
Description:
(-)-Kaitocephalin is a naturally occurring alkaloid that belongs to the class of compounds known as isoquinoline alkaloids. It is primarily derived from the plant species *Kaitocephalus*, which is known for its medicinal properties. The compound exhibits a complex molecular structure characterized by multiple chiral centers, contributing to its stereochemical properties. (-)-Kaitocephalin has been studied for its potential pharmacological effects, particularly in the context of neuroprotection and modulation of neurotransmitter systems. Its mechanism of action may involve interactions with various receptors in the central nervous system, although detailed studies are still ongoing to elucidate its full biological profile. The compound is typically analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many alkaloids, (-)-Kaitocephalin may exhibit a range of biological activities, making it a subject of interest in medicinal chemistry and pharmacology. However, further research is necessary to fully understand its therapeutic potential and safety profile.
Formula:C18H21Cl2N3O9
InChI:InChI=1S/C18H21Cl2N3O9/c19-8-3-6(4-9(20)12(8)24)14(26)22-10(15(27)28)5-7-1-2-18(23-7,17(31)32)13(25)11(21)16(29)30/h3-4,7,10-11,13,23-25H,1-2,5,21H2,(H,22,26)(H,27,28)(H,29,30)(H,31,32)/t7-,10+,11-,13+,18-/m1/s1
InChI key:InChIKey=AJQRDRIPQOAJCM-BWOKQULHSA-N
SMILES:[C@@H]([C@H](C(O)=O)N)(O)[C@]1(C(O)=O)N[C@@H](C[C@H](NC(=O)C2=CC(Cl)=C(O)C(Cl)=C2)C(O)=O)CC1
Synonyms:- Kaitocephalin
- (α2R,α5S,β2S,2R,5R)-α2-Amino-2-carboxy-α5-[(3,5-dichloro-4-hydroxybenzoyl)amino]-β2-hydroxy-2,5-pyrrolidinedipropanoic acid
- 2,5-Pyrrolidinedipropanoic acid, α2-amino-2-carboxy-α5-[(3,5-dichloro-4-hydroxybenzoyl)amino]-β2-hydroxy-, (α2R,α5S,β2S,2R,5R)-
- (-)-Kaitocephalin
- PF 1191
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Kaitocephalin
CAS:Kaitocephalin: naturally occurring, non-selective antagonist blocking glutamate receptors, made by Eupenicillium shearii fungus.Formula:C18H21Cl2N3O9Color and Shape:SolidMolecular weight:494.28
