CAS 19878-10-5
:Linoleic acid anilide
Description:
Linoleic acid anilide, with the CAS number 19878-10-5, is an organic compound derived from linoleic acid, a polyunsaturated fatty acid, and aniline, an aromatic amine. This compound typically appears as a viscous liquid or solid, depending on the specific conditions and purity. It is characterized by the presence of both a fatty acid moiety and an aniline group, which contributes to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic environments. Linoleic acid anilide is often studied for its potential applications in various fields, including biochemistry and materials science, due to its surfactant properties and ability to form micelles. Additionally, it may exhibit biological activity, making it of interest in pharmacological research. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, which are important factors to consider in its applications and handling.
Formula:C24H37NO
InChI:InChI=1S/C24H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-24(26)25-23-20-17-16-18-21-23/h6-7,9-10,16-18,20-21H,2-5,8,11-15,19,22H2,1H3,(H,25,26)/b7-6-,10-9-
InChI key:InChIKey=HFRLHSQAZLWVEE-HZJYTTRNSA-N
SMILES:N(C(CCCCCCC/C=C\C/C=C\CCCCC)=O)C1=CC=CC=C1
Synonyms:- 9,12-Octadecadienamide, N-phenyl-, (Z,Z)-
- (9Z,12Z)-N-Phenyl-9,12-octadecadienamide
- Linoleanilide
- 9,12-Octadecadienamide, N-phenyl-, (9Z,12Z)-
- Linoleic acid anilide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Linoleylanilide
CAS:Linoleylanilide is a fatty amide conjugate of linoleic acid and aniline.Formula:C24H37NOColor and Shape:SolidMolecular weight:355.56
