CAS 19879-84-6
:Tetra-O-acetyl-1-thio-β-D-glucopyranose
Description:
Tetra-O-acetyl-1-thio-β-D-glucopyranose is a thio derivative of glucose, characterized by the presence of a thio group (-S-) at the anomeric carbon (C1) and four acetyl groups attached to the hydroxyl groups of the glucose molecule. This compound is typically a white to off-white crystalline solid, soluble in organic solvents such as chloroform and acetone, but less soluble in water due to its acetylation. The acetyl groups enhance the lipophilicity of the molecule, making it useful in various chemical reactions and applications, particularly in carbohydrate chemistry and synthesis. The thio group can participate in nucleophilic substitution reactions, making this compound valuable in the synthesis of glycosides and other derivatives. Its structure allows for the study of glycosidic bond formation and the reactivity of thio sugars in biological systems. As a derivative of glucose, it retains some of the biological properties of carbohydrates, which can be exploited in medicinal chemistry and biochemistry.
Formula:C14H20O9S
InChI:InChI=1S/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1
InChI key:InChIKey=SFOZKJGZNOBSHF-RGDJUOJXSA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H](S)[C@@H]1OC(C)=O
Synonyms:- 1-Thio-beta-D-glucose 2,3,4,6-tetraacetate
- 1-Thio-β-<span class="text-smallcaps">D</span>-glucopyranose tetraacetate
- 1-Thio-β-<span class="text-smallcaps">D</span>-glucose tetraacetate
- 2,3,4,6-Tetra-O-acetyl-1-thio-β-<span class="text-smallcaps">D</span>-glucopyranose
- 2,3,4,6-Tetra-O-acetyl-1-thio-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2,3,4,6-Tetra-O-acetyl-1-thio-β-<span class="text-smallcaps">D</span>-glucose
- 2,3,4,6-Tetra-O-acetyl-1-thio-β-<span class="text-smallcaps">D</span>-glycopyranose
- 2,3,4,6-Tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-1-thioglucopyranoside
- 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-glucopyranose
- 2,3,4,6-tetra-O-acetyl-1-thiohexopyranose
- Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate
- Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate, β-<span class="text-smallcaps">D</span>-
- NSC 97032
- Skf 83940D
- Tetra-O-acetyl-1-thio-β-<span class="text-smallcaps">D</span>-glucopyranose
- β-<span class="text-smallcaps">D</span>-Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate
- β-<span class="text-smallcaps">D</span>-Thioglucopyranose 2,3,4,6-tetraacetate
- 2,3,4,6-Tetra-O-acetyl-1-thio-β-D-glucopyranose
- Tetra-O-acetyl-1-thio-β-D-glucopyranose
- Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate, β-D-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Thio-β-D-glucose tetraacetate, 98+%
CAS:1-Thio-beta-D-glucose tetraacetate is used as an inhibitor of the Maillard reaction between glucose and glycine. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origina
Formula:C14H20O9SPurity:98+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:364.37β-D-Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate
CAS:Formula:C14H20O9SPurity:95%Color and Shape:SolidMolecular weight:364.36821-thio-β-D-Glucose Tetraacetate
CAS:1-thio-β-D-Glucose tetraacetate is a building block.1,2It has been used in the synthesis of aromatic glucosinolates with anti-inflammatory activity, as well asFormula:C14H20O9SColor and Shape:SolidMolecular weight:364.371-Thio-β-D-glucose tetraacetate
CAS:1-Thio-β-D-glucose tetraacetate
Purity:98+%Color and Shape: white powderMolecular weight:364.37g/mol2,3,4,6-Tetra-O-acetyl-β-D-thioglucopyranose
CAS:Inhibits the Maillard reaction between glucose and glycineFormula:C14H20O9SPurity:Min. 95%Color and Shape:PowderMolecular weight:364.37 g/mol1-Thio-β-D-glucose tetraacetate
CAS:M04156 - 1-Thio-beta-D-glucose tetraacetate
Formula:C14H20O9SPurity:95%Color and Shape:SolidMolecular weight:364.371-Thio-b-D-glucopyranose 2,3,4,6-Tetraacetate
CAS:Controlled ProductApplications A synthetic intermediate.
Formula:C14H20O9SColor and Shape:White To Off-WhiteMolecular weight:364.368







