CAS 1988-10-9
:4-HYDROXY PROPOFOL
Description:
4-Hydroxypropofol is a chemical compound that is a derivative of propofol, which is widely known for its use as an anesthetic agent. This compound features a hydroxyl group (-OH) at the fourth position of the propofol structure, which influences its chemical properties and biological activity. It is characterized by its relatively low molecular weight and is typically a colorless to pale yellow liquid. The presence of the hydroxyl group enhances its solubility in water compared to propofol, which is primarily lipophilic. 4-Hydroxypropofol exhibits sedative and anesthetic properties, making it of interest in pharmacological research. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, it is important to consider its safety profile and potential side effects when used in medical applications. Overall, 4-hydroxypropofol serves as a significant compound in the study of anesthetic agents and their mechanisms of action.
Formula:C12H18O2
InChI:InChI=1/C12H18O2/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-8,13-14H,1-4H3
SMILES:CC(C)c1cc(cc(C(C)C)c1O)O
Synonyms:- 2,6-Bis(1-methylethyl)-1,4-benzenediol
- 2,6-Diisopropylhydroquinone
- 2,6-Di-Isopropyl-Hydroquinol
- 2,6-Bis(1-Methylethyl)Benzene-1,4-Diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-Hydroxy Propofol
CAS:Formula:C12H18O2Color and Shape:White To Off-White SolidMolecular weight:194.274-Hydroxy Propofol
CAS:Applications A metabolite of Propofol.
References Davies, M., et al.: Biochem. J., 257, 603 (1989), Eriksson, O., et al.: Biochem. Pharmacol., 44, 391 (1992), Bryson, H., et al.: Drugs, 50, 513, (1995), Raoof, A., et al.: Eur. J. Clin. Pharmacol., 50, 91 (1996)Formula:C12H18O2Color and Shape:NeatMolecular weight:194.27


