CymitQuimica logo

CAS 198821-79-3

:

3-METHOXY-4-(1,3-OXAZOL-5-YL)ANILINE

Description:
3-Methoxy-4-(1,3-oxazol-5-yl)aniline, with the CAS number 198821-79-3, is an organic compound characterized by its aromatic amine structure. It features a methoxy group (-OCH3) and a 1,3-oxazole ring, which contributes to its unique chemical properties. The presence of the oxazole ring suggests potential biological activity, as heterocycles often play significant roles in medicinal chemistry. This compound is likely to exhibit moderate solubility in organic solvents due to its polar methoxy group and the aromatic nature of the aniline moiety. Its molecular structure may allow for hydrogen bonding and interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the oxazole, which may affect its synthesis and application in various chemical reactions. Overall, 3-methoxy-4-(1,3-oxazol-5-yl)aniline is a compound with potential utility in drug development and other chemical applications.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-13-9-4-7(11)2-3-8(9)10-5-12-6-14-10/h2-6H,11H2,1H3
InChI key:KYCMMXMEXWSPCV-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)N)C2=CN=CO2
Found 5 products.