CAS 19883-27-3
:(3E,5Z)-1,3,5-Undecatriene
Description:
(3E,5Z)-1,3,5-Undecatriene is an organic compound characterized by its long carbon chain and specific geometric configurations of its double bonds. It features a total of 11 carbon atoms and contains three double bonds, which contribute to its unsaturated nature. The notation (3E,5Z) indicates the configuration of the double bonds, with the "E" (entgegen) designation at the third position and the "Z" (zusammen) designation at the fifth position, reflecting the spatial arrangement of substituents around the double bonds. This compound is typically a colorless liquid at room temperature and is known for its distinct odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. (3E,5Z)-1,3,5-Undecatriene is of interest in various fields, including organic synthesis and fragrance chemistry, due to its potential applications in the production of pheromones and other biologically active compounds. Its reactivity is influenced by the presence of multiple double bonds, making it a versatile intermediate in chemical reactions.
Formula:C11H18
InChI:InChI=1S/C11H18/c1-3-5-7-9-11-10-8-6-4-2/h3,5,7,9,11H,1,4,6,8,10H2,2H3/b7-5+,11-9-
InChI key:InChIKey=JQQDKNVOSLONRS-STRRHFTISA-N
SMILES:C(\CCCCC)=C\C=C\C=C
Synonyms:- 1,3,5-Undecatriene, (3E,5Z)-
- 3-trans,5-cis-1,3,5-Undecatriene
- (3E,5Z)-1,3,5-Undecatriene
- 1,3,5-Undecatriene, (Z,E)-
- (Z,E)-1,3,5-Undecatriene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
