CymitQuimica logo

CAS 198835-03-9

:

rel-1,1-Dimethylethyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate

Description:
Rel-1,1-Dimethylethyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, with CAS number 198835-03-9, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom within a seven-membered ring. This compound features a hydroxyl group (-OH) and a carboxylate group (-COO-) that contribute to its reactivity and potential biological activity. The presence of the dimethyl group indicates steric hindrance, which can influence the compound's interaction with biological targets. The specific stereochemistry, denoted by the (1R,4R,5S) configuration, suggests that the compound may exhibit chirality, leading to different biological activities depending on the orientation of its functional groups. Such compounds are often of interest in medicinal chemistry due to their potential as pharmaceuticals or as intermediates in the synthesis of more complex molecules. Overall, the unique structural features of this compound may confer specific properties that are valuable in various chemical and biological applications.
Formula:C11H19NO3
InChI:InChI=1/C11H19NO3/c1-11(2,3)15-10(14)12-6-7-4-8(12)5-9(7)13/h7-9,13H,4-6H2,1-3H3/t7-,8-,9+/s2
InChI key:InChIKey=HDPGSWMTDGGUEB-NGWRPYAKNA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@]2(C[C@@](C1)([C@H](O)C2)[H])[H]
Synonyms:
  • 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester, (1R,4R,5S)-rel-
  • 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester, exo-
  • rel-1,1-Dimethylethyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate
Found 4 products.