CAS 19887-32-2
:N-ethoxycarbonyl-L-phenylalanine
Description:
N-ethoxycarbonyl-L-phenylalanine is an amino acid derivative characterized by the presence of an ethoxycarbonyl group attached to the amino acid phenylalanine. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic phenyl group. The ethoxycarbonyl moiety enhances its stability and can influence its reactivity, making it useful in peptide synthesis and as a building block in organic chemistry. The presence of the L-phenylalanine structure contributes to its chirality, which is significant in biological systems and pharmaceutical applications. This compound may be utilized in various biochemical applications, including drug design and synthesis, due to its ability to participate in peptide bond formation. Additionally, its properties can be influenced by factors such as pH and temperature, which can affect its solubility and reactivity. Overall, N-ethoxycarbonyl-L-phenylalanine serves as an important intermediate in the synthesis of more complex molecules in medicinal chemistry and biochemistry.
Formula:C12H15NO4
InChI:InChI=1/C12H15NO4/c1-2-17-12(16)13-10(11(14)15)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,13,16)(H,14,15)/t10-/m0/s1
SMILES:CCOC(=N[C@@H](Cc1ccccc1)C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Phenylalanine, N-(ethoxycarbonyl)-
CAS:Formula:C12H15NO4Purity:98%Color and Shape:SolidMolecular weight:237.2518N-Ethoxycarbonyl-L-phenylalanine
CAS:N-Ethoxycarbonyl-L-phenylalaninePurity:98%Molecular weight:237.25g/mol2-[(ethoxycarbonyl)amino]-3-phenylpropanoic acid
CAS:<p>2-[(Ethoxycarbonyl)amino]-3-phenylpropanoic acid is an organic compound that is used as a reagent for the synthesis of esters. It has been used in the synthesis of methylene, carbonic, and chiral pentafluorophenol. 2-[(Ethoxycarbonyl)amino]-3-phenylpropanoic acid has also been shown to be analogous to ethyl chloroformate, yielding high yields with less reactive conditions than ethyl chloroformate. 2-[(Ethoxycarbonyl)amino]-3-phenylpropanoic acid can be used to synthesize active esters such as 1-hydroxybenzotriazole by reacting with n-hydroxysuccinimide and chloroformate.</p>Formula:C12H15NO4Purity:Min. 95%Molecular weight:237.26 g/mol




