CAS 19888-34-7
:(-)-Humulene epoxide II
Description:
(-)-Humulene epoxide II, with the CAS number 19888-34-7, is a bicyclic monoterpene epoxide derived from humulene, a natural compound found in various plants, particularly hops. This compound is characterized by its unique epoxide functional group, which contributes to its reactivity and potential biological activity. (-)-Humulene epoxide II exhibits a complex three-dimensional structure, which influences its interactions with biological systems, making it of interest in pharmacological research. It is known for its potential anti-inflammatory and antimicrobial properties, which are being explored in various studies. Additionally, this compound may play a role in the aroma and flavor profiles of certain plants, contributing to their sensory characteristics. As a naturally occurring substance, it is often studied in the context of natural product chemistry and its applications in food, cosmetics, and therapeutic agents. Its stability and reactivity can vary depending on environmental conditions, making it a subject of interest in both synthetic and natural chemistry research.
Formula:C15H24O
InChI:InChI=1S/C15H24O/c1-12-6-7-13-15(4,16-13)10-5-9-14(2,3)11-8-12/h5,8-9,13H,6-7,10-11H2,1-4H3/b9-5+,12-8+/t13-,15-/m1/s1
InChI key:InChIKey=QTGAEXCCAPTGLB-UOAUIWSESA-N
SMILES:C[C@@]12[C@](O1)(CC\C(\C)=C\CC(C)(C)\C=C\C2)[H]
Synonyms:- (1R,3E,7E,11R)-1,5,5,8-Tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene
- 12-Oxabicyclo[9.1.0]dodeca-3,7-diene, 1,5,5,8-tetramethyl-, (1R,3E,7E,11R)-
- 12-Oxabicyclo[9.1.0]dodeca-3,7-diene, 1,5,5,8-tetramethyl-, (E,E)-(1R,11R)-(-)-
- 12-Oxabicyclo[9.1.0]dodeca-3,7-diene, 1,5,5,8-tetramethyl-, [1R-(1R*,3E,7E,11R*)]-
- Humulene 1,2-epoxide
- Humulene 6,7-epoxide
- Humulene II epoxide
- Humulene oxide II
- α-Humulene epoxide II
- (-)-Humulene epoxide II
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
12-Oxabicyclo[9.1.0]dodeca-3,7-diene, 1,5,5,8-tetramethyl-, (1R,3E,7E,11R)-
CAS:Formula:C15H24OPurity:97%Color and Shape:SolidMolecular weight:220.3505Humulene epoxide II
CAS:Humulene epoxide II has antimalarial activity.Formula:C15H24OPurity:98%Color and Shape:SolidMolecular weight:220.356Humulene epoxide II
CAS:Humulene epoxide II is a sesquiterpene oxide, which is a naturally occurring product derived from the essential oils of plants like cannabis and hops. This compound is characterized by its structural modification of humulene through the addition of an epoxide group, making it a versatile component in plant secondary metabolism.Formula:C15H24OPurity:Min. 95%Molecular weight:220.35 g/mol



