CymitQuimica logo

CAS 198896-00-3

:

(2R,5S)-1-benzyl-2,5-dimethyl-piperazine dihydrochloride

Description:
(2R,5S)-1-benzyl-2,5-dimethyl-piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The specific stereochemistry indicated by the (2R,5S) configuration suggests that the compound has distinct spatial arrangements that can influence its biological activity and interactions. The presence of a benzyl group and two methyl groups on the piperazine ring contributes to its hydrophobic characteristics, potentially affecting its solubility and permeability in biological systems. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions with biological targets would depend on its structural features and stereochemistry, which can influence receptor binding and activity.
Formula:C13H22Cl2N2
InChI:InChI=1/C13H20N2.2ClH/c1-11-9-15(12(2)8-14-11)10-13-6-4-3-5-7-13;;/h3-7,11-12,14H,8-10H2,1-2H3;2*1H/t11-,12+;;/m0../s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.