CAS 198904-53-9

4-(1,3-THIAZOL-2-YL)BENZALDEHYDE

Description:

4-(1,3-Thiazol-2-yl)benzaldehyde is an organic compound characterized by the presence of a thiazole ring and a benzaldehyde functional group. The thiazole moiety contributes to its heterocyclic nature, which can influence its reactivity and biological activity. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the aldehyde group makes it a versatile intermediate in organic synthesis, allowing for further functionalization and derivatization. Additionally, the thiazole ring can impart unique electronic properties, making it useful in various chemical reactions, including condensation and substitution reactions. Its solubility may vary depending on the solvent, and it is generally handled with standard safety precautions due to potential toxicity. Overall, 4-(1,3-thiazol-2-yl)benzaldehyde is a compound of interest in both academic research and industrial applications.

Formula: C₁₀H₇NOS

InChI: InChI=1/C10H7NOS/c12-7-8-1-3-9(4-2-8)10-11-5-6-13-10/h1-7H

SMILES: c1cc(ccc1C=O)c1nccs1

Synonyms:

• 4-Thiazol-2-Yl-Benzaldehyde
• 2-(4-Formylphenyl)thiazole-4-carboxylic acid
• 2-(4-Formylphenyl)thiazole-5-carboxylic acid
• 4-(5-Nitrothiazol-2-yl)benzaldehyde
• 4-Thiazol-2-Yl-Benzaldehyde, 95+%

Benzaldehyde, 4-(2-thiazolyl)-

CAS: 198904-53-9

Formula: C₁₀H₇NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.2337

Ref: IN-DA002BTE

4-(Thiazol-2-yl)benzaldehyde

CAS: 198904-53-9

4-(Thiazol-2-yl)benzaldehyde

Purity: 97%

Molecular weight: 189.23g/mol

Ref: 54-OR346576

4-(1,3-Thiazol-2-yl)benzaldehyde

CAS: 198904-53-9

Formula: C₁₀H₇NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.23

Ref: 10-F065164