CAS 198964-46-4
:9,9-Dioctyl-2,7-dibromofluorene
Description:
9,9-Dioctyl-2,7-dibromofluorene is an organic compound characterized by its unique structure, which includes a fluorene backbone substituted with two bromine atoms and two octyl groups. This compound is notable for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs), due to its favorable electronic properties and solubility. The presence of bromine atoms enhances its reactivity and can facilitate further chemical modifications, while the octyl groups contribute to its solubility in organic solvents, making it suitable for solution-processing techniques. Additionally, the compound exhibits good thermal stability, which is essential for maintaining performance in electronic applications. Its molecular structure allows for effective π-π stacking, which is beneficial for charge transport in electronic devices. Overall, 9,9-Dioctyl-2,7-dibromofluorene is a significant material in the field of organic electronics, combining desirable physical and chemical properties for advanced applications.
Formula:C29H40Br2
InChI:InChI=1/C29H40Br2/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(30)15-17-25(27)26-18-16-24(31)22-28(26)29/h15-18,21-22H,3-14,19-20H2,1-2H3
SMILES:CCCCCCCCC1(CCCCCCCC)c2cc(ccc2c2ccc(cc12)Br)Br
Synonyms:- 9,9-Dioctyl-2,7-diformylfluorne
- 9,9-Dioctyl-2,7-Diformylfluorene
- 2,7-dibromo-9,9-dioctyl-9H-fluorene
- 2,7-Dibromo-9,9-di-n-octylfluorene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,7-Dibromo-9,9-di-n-octylfluorene
CAS:Formula:C29H40Br2Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:548.459,9-DIOCTYL-2,7-DIBROMOFLUORENE
CAS:Formula:C29H40Br2Purity:98%Color and Shape:SolidMolecular weight:548.43599,9-Dioctyl-2,7-dibromofluorene
CAS:9,9-Dioctyl-2,7-dibromofluorenePurity:98%Molecular weight:548.44g/mol9,9-Dioctyl-7-dibromofluorene
CAS:9,9-Dioctyl-7-dibromofluorene is a linear polymer with an ethylene diamine backbone. It is a synthetic material that can be used for devices such as solar cells. 9,9-Dioctyl-7-dibromofluorene has been shown to have efficient light emission properties and high optical absorption in the visible region of the electromagnetic spectrum. The device efficiency of this material has been shown to be improved by substituent effects and reaction time.Formula:C29H40Br2Purity:Min. 95%Molecular weight:548.44 g/mol





