CAS 1989659-68-8

1,1-Dimethylethyl 2,6-dimethyl-3-piperidinecarboxylate

Description:

1,1-Dimethylethyl 2,6-dimethyl-3-piperidinecarboxylate, identified by its CAS number 1989659-68-8, is an organic compound characterized by its piperidine structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of dimethyl groups on both the piperidine ring and the tert-butyl group enhances its steric bulk, which can influence its chemical behavior, including its solubility and reactivity. Typically, such compounds may exhibit properties like moderate polarity and potential for hydrogen bonding due to the carboxylate group. They may also serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental data or computational chemistry methods.

Formula: C₁₂H₂₃NO₂

InChI: InChI=1S/C12H23NO2/c1-8-6-7-10(9(2)13-8)11(14)15-12(3,4)5/h8-10,13H,6-7H2,1-5H3

InChI key: InChIKey=GNDMYZBKBJRDSQ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)C1C(C)NC(C)CC1

Synonyms:

• 3-Piperidinecarboxylic acid, 2,6-dimethyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2,6-dimethyl-3-piperidinecarboxylate

tert-Butyl 2,6-dimethylpiperidine-3-carboxylate

CAS: 1989659-68-8

Versatile small molecule scaffold

Formula: C₁₂H₂₃NO₂

Purity: Min. 95%

Molecular weight: 213.32 g/mol

Ref: 3D-PED65968