CAS 1989659-85-9

Azetidine, 3-[(2-methylphenyl)methyl]-, hydrochloride (1:1)

Description:

Azetidine, 3-[(2-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The compound features a 2-methylphenyl group attached to the azetidine at the 3-position, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the hydrochloride indicates that the compound is protonated, which can influence its stability, solubility, and interaction with biological systems. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and are essential for understanding its behavior in different environments. Overall, azetidine derivatives are often studied for their potential in drug development due to their structural diversity and biological relevance.

Formula: C₁₁H₁₅N·ClH

InChI: InChI=1S/C11H15N.ClH/c1-9-4-2-3-5-11(9)6-10-7-12-8-10;/h2-5,10,12H,6-8H2,1H3;1H

InChI key: InChIKey=UTIHFFCSJQNTET-UHFFFAOYSA-N

SMILES: C(C1=C(C)C=CC=C1)C2CNC2.Cl

Synonyms:

• Azetidine, 3-[(2-methylphenyl)methyl]-, hydrochloride (1:1)
• 3-(2-Methylbenzyl)azetidine hydrochloride

3-[(2-Methylphenyl)methyl]azetidine hydrochloride

CAS: 1989659-85-9

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN

Purity: Min. 95%

Molecular weight: 197.7 g/mol

Ref: 3D-PED65985