CymitQuimica logo

CAS 198967-24-7

:

2-Fluoro-N-methoxy-N-methylbenzamide

Description:
2-Fluoro-N-methoxy-N-methylbenzamide is an organic compound characterized by its specific functional groups and structural features. It contains a benzamide backbone, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of a fluorine atom at the 2-position of the aromatic ring introduces unique electronic and steric properties, potentially influencing its reactivity and interactions. The methoxy (-OCH3) and methyl (-CH3) substituents on the nitrogen atom contribute to the compound's overall polarity and solubility characteristics. This compound may exhibit interesting biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can affect its behavior in different environments. As with many fluorinated compounds, it may also exhibit enhanced stability and lipophilicity, impacting its pharmacokinetic properties. Overall, 2-Fluoro-N-methoxy-N-methylbenzamide represents a unique chemical entity with potential applications in various fields.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c1-11(13-2)9(12)7-5-3-4-6-8(7)10/h3-6H,1-2H3
InChI key:InChIKey=WWEPCBKULBKDCS-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=C(F)C=CC=C1
Synonyms:
  • 2-Fluoro-N-methoxy-N-metylbenzamide
  • Benzamide, 2-fluoro-N-methoxy-N-methyl-
  • N-Methoxy-N-methyl-2-fluorobenzamide
  • 2-Fluoro-N-methoxy-N-methylbenzamide
Found 4 products.