CAS 1989671-47-7

1,7-Naphthyridin-8(2H)-one, 1,3,4,7-tetrahydro-, hydrochloride (1:1)

Description:

1,7-Naphthyridin-8(2H)-one, 1,3,4,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturated nature. The hydrochloride form suggests that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the naphthyridine ring system often correlates with biological activity, as many derivatives exhibit antimicrobial, antiviral, or anticancer properties. The compound's molecular structure may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the hydrochloride salt form typically improves stability and bioavailability. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.

Formula: C₈H₁₀N₂O·ClH

InChI: InChI=1S/C8H10N2O.ClH/c11-8-7-6(3-5-10-8)2-1-4-9-7;/h3,5,9H,1-2,4H2,(H,10,11);1H

InChI key: InChIKey=IQWCJIFZECOLNY-UHFFFAOYSA-N

SMILES: O=C1C2=C(C=CN1)CCCN2.Cl

Synonyms:

• 1,7-Naphthyridin-8(2H)-one, 1,3,4,7-tetrahydro-, hydrochloride (1:1)

1,2,3,4,7,8-Hexahydro-1,7-naphthyridin-8-one hydrochloride

CAS: 1989671-47-7

Versatile small molecule scaffold

Formula: C₈H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 186.64 g/mol

Ref: 3D-PED67147