CAS 1989671-49-9

Methyl 1-(2,2,2-trifluoroethyl)-4-piperidineacetate

Description:

Methyl 1-(2,2,2-trifluoroethyl)-4-piperidineacetate is a chemical compound characterized by its unique structure, which includes a piperidine ring and a trifluoroethyl group. This compound typically exhibits properties associated with both its piperidine moiety and the presence of fluorine atoms, which can influence its reactivity and polarity. The trifluoroethyl group is known for imparting lipophilicity and can enhance the compound's biological activity, making it of interest in medicinal chemistry. The acetate functional group suggests that it may participate in esterification reactions and could be hydrolyzed under certain conditions. Additionally, the presence of fluorine atoms often contributes to increased stability and altered pharmacokinetics in biological systems. Overall, Methyl 1-(2,2,2-trifluoroethyl)-4-piperidineacetate is a compound that may have applications in drug development and research, particularly in areas requiring compounds with specific pharmacological properties.

Formula: C₁₀H₁₆F₃NO₂

InChI: InChI=1S/C10H16F3NO2/c1-16-9(15)6-8-2-4-14(5-3-8)7-10(11,12)13/h8H,2-7H2,1H3

InChI key: InChIKey=DCLZRICNDCZHST-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)N1CCC(CC(OC)=O)CC1

Synonyms:

• 4-Piperidineacetic acid, 1-(2,2,2-trifluoroethyl)-, methyl ester
• Methyl 1-(2,2,2-trifluoroethyl)-4-piperidineacetate

Methyl 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]acetate

CAS: 1989671-49-9

Versatile small molecule scaffold

Formula: C₁₀H₁₆F₃NO₂

Purity: Min. 95%

Molecular weight: 239.23 g/mol

Ref: 3D-PED67149