CAS 1989672-46-9

6-(Phenylmethyl)-6-azaspiro[3.4]octane-8-methanamine

Description:

6-(Phenylmethyl)-6-azaspiro[3.4]octane-8-methanamine is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a nitrogen atom and a phenylmethyl group. This compound features a bicyclic framework that includes a piperidine-like ring fused to a cyclohexane-like structure, contributing to its rigidity and potential biological activity. The presence of the methanamine functional group suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including those typical of amines. The phenylmethyl substituent can enhance lipophilicity, potentially influencing the compound's solubility and permeability in biological systems. Such structural characteristics may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. However, detailed studies on its pharmacodynamics, toxicity, and specific applications would be necessary to fully understand its properties and potential uses.

Formula: C₁₅H₂₂N₂

InChI: InChI=1S/C15H22N2/c16-9-14-11-17(12-15(14)7-4-8-15)10-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12,16H2

InChI key: InChIKey=GMASNXQZSDUFSG-UHFFFAOYSA-N

SMILES: C(N)C1C2(CN(CC3=CC=CC=C3)C1)CCC2

Synonyms:

• 6-Azaspiro[3.4]octane-8-methanamine, 6-(phenylmethyl)-
• [6-Benzyl-6-azaspiro[3.4]octan-8-yl]methanamine
• 6-(Phenylmethyl)-6-azaspiro[3.4]octane-8-methanamine

{6-Benzyl-6-azaspiro[3.4]octan-8-yl}methanamine

CAS: 1989672-46-9

Versatile small molecule scaffold

Formula: C₁₅H₂₂N₂

Purity: Min. 95%

Molecular weight: 230.35 g/mol

Ref: 3D-PED67246