CAS 1989672-77-6

2,2,2-Trifluoroethyl N-[5-(dimethylamino)-2-pyridinyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[5-(dimethylamino)-2-pyridinyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a pyridine moiety. This compound is likely to exhibit properties typical of carbamates, such as moderate to high stability under standard conditions, and it may be sensitive to hydrolysis in the presence of strong acids or bases. The presence of the trifluoroethyl group can impart lipophilicity, potentially influencing its solubility in organic solvents and its biological activity. The dimethylamino group attached to the pyridine ring may enhance its basicity and reactivity, making it a candidate for various applications in medicinal chemistry or agrochemicals. Additionally, the compound's fluorinated structure may contribute to unique electronic properties, affecting its interaction with biological targets. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the potential toxicity associated with fluorinated compounds and the dimethylamino group.

Formula: C₁₀H₁₂F₃N₃O₂

InChI: InChI=1S/C10H12F3N3O2/c1-16(2)7-3-4-8(14-5-7)15-9(17)18-6-10(11,12)13/h3-5H,6H2,1-2H3,(H,14,15,17)

InChI key: InChIKey=LANMJINOCBIPHU-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC=C(N(C)C)C=N1

Synonyms:

• 2,2,2-Trifluoroethyl N-[5-(dimethylamino)-2-pyridinyl]carbamate
• Carbamic acid, N-[5-(dimethylamino)-2-pyridinyl]-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-[5-(dimethylamino)pyridin-2-yl]carbamate

CAS: 1989672-77-6

Versatile small molecule scaffold

Formula: C₁₀H₁₂F₃N₃O₂

Purity: Min. 95%

Molecular weight: 263.22 g/mol

Ref: 3D-PED67277