CymitQuimica logo

CAS 199014-14-7

:

(2-(4-Methoxybenzyl)-2H-1,2,4-triazol-3-yl)methanol

Description:
The chemical substance known as (2-(4-Methoxybenzyl)-2H-1,2,4-triazol-3-yl)methanol, with the CAS number 199014-14-7, is characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methoxybenzyl group, contributing to its potential for various biological activities, including antimicrobial and antifungal properties. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The triazole moiety is known for its ability to form hydrogen bonds, which can be crucial in drug design and molecular recognition processes. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially modulating its pharmacological effects. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C11H13N3O2
InChI:InChI=1/C11H13N3O2/c1-16-10-4-2-9(3-5-10)6-14-11(7-15)12-8-13-14/h2-5,8,15H,6-7H2,1H3
SMILES:COc1ccc(cc1)Cn1c(CO)ncn1
Synonyms:
  • 1-[(4-Methoxyphenyl)methyl]-1H-1,2,4-triazole-5-methanol
  • [1-(4-methoxybenzyl)-1H-1,2,4-triazol-5-yl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.