CAS 199105-17-4: 2-(4-Benzyl-piperazin-1-yl)aniline
Description:2-(4-Benzyl-piperazin-1-yl)aniline, identified by its CAS number 199105-17-4, is a chemical compound that features a piperazine ring substituted with a benzyl group and an aniline moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its interactions with various biological targets. The presence of the piperazine ring contributes to its ability to engage in hydrogen bonding and interact with receptors, making it of interest in pharmacological studies. Additionally, the benzyl and aniline groups enhance its lipophilicity, which can influence its absorption and distribution in biological systems. The compound may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. Its structural features suggest potential applications in drug development, particularly in the fields of neuropharmacology and psychopharmacology, where piperazine derivatives are frequently investigated for their therapeutic effects. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H21N3
InChI:InChI=1/C17H21N3/c18-16-8-4-5-9-17(16)20-12-10-19(11-13-20)14-15-6-2-1-3-7-15/h1-9H,10-14,18H2
- Synonyms:
- 2-(4-Benzylpiperazin-1-yl)aniline
- Benzenamine, 2-[4-(Phenylmethyl)-1-Piperazinyl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzenamine, 2-[4-(phenylmethyl)-1-piperazinyl]- REF: IN-DA002BWQCAS: 199105-17-4 | 97% | To inquire | Mon 14 Apr 25 |
![]() | 2-(4-Benzylpiperazin-1-yl)aniline REF: 10-F771923CAS: 199105-17-4 | 98% | - - - | Discontinued product |
![]() | 2-(4-Benzyl-1-piperazinyl)aniline REF: 3D-ZHA10517CAS: 199105-17-4 | Min. 95% | - - - | Discontinued product |

Benzenamine, 2-[4-(phenylmethyl)-1-piperazinyl]-
Ref: IN-DA002BWQ
1g | 339.00 € | ||
5g | To inquire | ||
500mg | 228.00 € |

Ref: 10-F771923
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |

2-(4-Benzyl-1-piperazinyl)aniline
Ref: 3D-ZHA10517
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |