CAS 199117-79-8

1-(2-Pyridinyl)-4-piperidinemethanol

Description:

1-(2-Pyridinyl)-4-piperidinemethanol, identified by its CAS number 199117-79-8, is a chemical compound characterized by its unique structure that includes a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility and reactivity. It is often studied for its potential biological activities, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the hydroxymethyl group contributes to its ability to form hydrogen bonds, enhancing its interactions with biological targets. Additionally, the compound's molecular structure suggests it may possess lipophilic characteristics, which can affect its pharmacokinetics and bioavailability. Overall, 1-(2-Pyridinyl)-4-piperidinemethanol is of interest in various research fields, including drug discovery and development, due to its potential therapeutic applications and the diverse chemical reactivity it may exhibit.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1S/C11H16N2O/c14-9-10-4-7-13(8-5-10)11-3-1-2-6-12-11/h1-3,6,10,14H,4-5,7-9H2

InChI key: InChIKey=GVAWIUOVSIOZFQ-UHFFFAOYSA-N

SMILES: C(O)C1CCN(CC1)C2=CC=CC=N2

Synonyms:

• 4-Piperidinemethanol, 1-(2-pyridinyl)-
• 1-(2-Pyridinyl)-4-piperidinemethanol
• [1-(Pyridin-2-yl)piperidin-4-yl]methanol

[1-(Pyridin-2-yl)piperidin-4-yl]methanol

CAS: 199117-79-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O

Purity: Min. 95%

Molecular weight: 192.26 g/mol

Ref: 3D-ZHA11779