CAS 19912-36-8

N-cbz-gly-gly-ala

Description:

N-Cbz-gly-gly-ala, also known as N-carbobenzyloxy-glycyl-glycyl-alanine, is a peptide derivative characterized by its specific amino acid sequence and protective carbobenzyloxy (Cbz) group. This compound features two glycine residues followed by an alanine, making it a tripeptide. The Cbz group serves as a protective moiety for the amino group of the glycine, enhancing the stability and solubility of the peptide in various solvents. N-Cbz-gly-gly-ala is typically utilized in peptide synthesis and research, particularly in studies involving peptide coupling reactions and the development of peptide-based pharmaceuticals. Its structure allows for potential applications in drug design, as modifications can be made to the peptide backbone to enhance biological activity or specificity. The compound is generally stable under standard laboratory conditions but may require careful handling to avoid hydrolysis or degradation. As with many peptides, its properties can be influenced by factors such as pH, temperature, and the presence of solvents or other reagents.

Formula: C₁₅H₁₉N₃O₆

InChI: InChI=1/C15H19N3O6/c1-10(14(21)22)18-13(20)8-16-12(19)7-17-15(23)24-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,16,19)(H,17,23)(H,18,20)(H,21,22)

SMILES: CC(C(=O)O)N=C(CN=C(CN=C(O)OCc1ccccc1)O)O

Synonyms:

• Z-Gly-Gly-Ala-OH
• N-[(benzyloxy)carbonyl]glycylglycylalanine

Z-Gly-Gly-Ala-OH

CAS: 19912-36-8

Please enquire for more information about Z-Gly-Gly-Ala-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₉N₃O₆

Purity: Min. 95%

Molecular weight: 337.33 g/mol

Ref: 3D-FG111466