CAS 19912-84-6

7,7-dimethyl-11-methylidenespiro[5.5]undec-2-ene-3-carbaldehyde

Description:

7,7-Dimethyl-11-methylidenespiro[5.5]undec-2-ene-3-carbaldehyde, with the CAS number 19912-84-6, is an organic compound characterized by its complex spirocyclic structure. This compound features a spiro junction, which is a unique arrangement where two rings share a single atom, contributing to its distinctive three-dimensional shape. The presence of multiple methyl groups indicates a degree of branching, which can influence its physical properties, such as boiling point and solubility. The aldehyde functional group (-CHO) suggests that it can participate in various chemical reactions, including oxidation and condensation. This compound may exhibit interesting reactivity due to its unsaturation and steric hindrance from the bulky methyl groups. Additionally, its structural complexity may lead to unique optical properties, making it of interest in fields such as organic synthesis and materials science. Overall, 7,7-dimethyl-11-methylidenespiro[5.5]undec-2-ene-3-carbaldehyde is a notable example of a spiro compound with potential applications in various chemical contexts.

Formula: C₁₅H₂₂O

InChI: InChI=1/C15H22O/c1-12-5-4-8-14(2,3)15(12)9-6-13(11-16)7-10-15/h6,11H,1,4-5,7-10H2,2-3H3

SMILES: C=C1CCCC(C)(C)C21CC=C(CC2)C=O

Spiro[5.5]undec-2-ene-3-carboxaldehyde, 7,7-dimethyl-11-methylene-, (-)-

CAS: 19912-84-6

Formula: C₁₅H₂₂O

Purity: 98%

Molecular weight: 218.3346

Ref: IN-DA002BXR

Chamigrenal

CAS: 19912-84-6

Chamigrenal

Purity: ≥98%

Molecular weight: 218.33g/mol

Ref: 54-BUP21283

Chamigrenal

CAS: 19912-84-6

β-Chamigrenal: Anti-inflammatory, inhibits NO and PGE2 in macrophages, PAF antagonist (IC50=1.2x10^-4 M), weakly cytotoxic to MCF-7 (IC50=30.50 uM).

Formula: C₁₅H₂₂O

Purity: 99.31%

Color and Shape: Solid

Molecular weight: 218.33

Ref: TM-T3P2855

chamigrenal

CAS: 19912-84-6

Formula: C₁₅H₂₂O

Purity: 95%~99%

Molecular weight: 218.34

Ref: BP-BP3092

Chamigrenal

CAS: 19912-84-6

Chamigrenal is a complex enzyme that is extracted from the fruit of the chamomile plant, which has been used for centuries in Ayurvedic medicine. Chamigrenal has been shown to have anti-inflammatory and anti-allergic activities. It also binds to G-protein coupled receptors, which may be due to its eluting property. Chamigrenal contains many chemical structures, including phenolic acids, flavonoids, terpenoids, and coumarins. The molecule has been shown to inhibit the growth of human cervical carcinoma cells by binding to a receptor called factor receptor.
DEFINITION: Chamigrenal is an extract from the fruit of the chamomile plant that has been used for centuries in Ayurvedic medicine as a treatment for inflammation and allergies. It has also been shown to bind to G-protein coupled receptors and inhibit human cervical carcinoma cells by binding to a receptor called factor receptor.

Formula: C₁₅H₂₂O

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 218.33 g/mol

Ref: 3D-FC74404